* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Propyn-1-one, 1-(4-nitrophenyl)- |
CAS: | 37176-75-3 |
English Synonyms: | 2-PROPYN-1-ONE, 1-(4-NITROPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | [N+](=O)([O-])C1=CC=C(C=C1)C(C#C)=O |
InChi: | InChI=1S/C9H5NO3/c1-2-9(11)7-3-5-8(6-4-7)10(12)13/h1,3-6H |
InChiKey: | InChIKey=ADFALBPJQDKCFO-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.