* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VERMICULINE |
CAS: | 37244-00-1 |
English Synonyms: | VERMICULINE |
MDL Number.: | MFCD00466948 |
H bond acceptor: | 8 |
H bond donor: | 0 |
Smile: | CC(=O)C[C@@H]1CCC(=O)/C=C/C(=O)O[C@@H](CCC(=O)/C=C/C(=O)O1)CC(=O)C |
InChi: | InChI=1S/C20H24O8/c1-13(21)11-17-7-3-15(23)6-10-20(26)28-18(12-14(2)22)8-4-16(24)5-9-19(25)27-17/h5-6,9-10,17-18H,3-4,7-8,11-12H2,1-2H3/b9-5+,10-6+/t17-,18-/m0/s1 |
InChiKey: | InChIKey=CFDVIOQSLRJWSU-OFBGZIBBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.