* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WARFARIN-S |
CAS: | 37341-99-4 |
English Synonyms: | WARFARIN-S |
MDL Number.: | MFCD01657696 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(=O)CC(c1ccccc1)c2c(c3ccccc3oc2=O)O.c1ccc2c(c1)ncc(n2)NS(=O)(=O)c3ccc(cc3)N |
InChi: | InChI=1S/C19H16O4.C14H12N4O2S/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22;15-10-5-7-11(8-6-10)21(19,20)18-14-9-16-12-3-1-2-4-13(12)17-14/h2-10,15,21H,11H2,1H3;1-9H,15H2,(H,17,18) |
InChiKey: | InChIKey=SUVPVVDTHJRFJI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.