* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,2'-OXYDIBENZOIC ACID |
CAS: | 37424-29-6 |
English Synonyms: | 2,2'-OXYDIBENZOIC ACID |
MDL Number.: | MFCD00087060 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccc(c(c1)C(=O)O)Oc2ccccc2C(=O)O |
InChi: | InChI=1S/C14H10O5/c15-13(16)9-5-1-3-7-11(9)19-12-8-4-2-6-10(12)14(17)18/h1-8H,(H,15,16)(H,17,18) |
InChiKey: | InChIKey=UOFDVLCOMURSTA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.