* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-CHLORO-3H-IMIDAZO[4,5-B]PYRIDIN-5-AMINE |
CAS: | 37436-96-7 |
English Synonyms: | 7-CHLORO-3H-IMIDAZO[4,5-B]PYRIDIN-5-AMINE |
MDL Number.: | MFCD16877665 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1c(c2c([nH]cn2)nc1N)Cl |
InChi: | InChI=1S/C6H5ClN4/c7-3-1-4(8)11-6-5(3)9-2-10-6/h1-2H,(H3,8,9,10,11) |
InChiKey: | InChIKey=YCKDTQDJPNPXGA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.