* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2-Ethanediamine, N1-(3,5-dichlorophenyl)- |
CAS: | 37443-75-7 |
English Synonyms: | 1,2-ETHANEDIAMINE, N1-(3,5-DICHLOROPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC=1C=C(C=C(C1)Cl)NCCN |
InChi: | InChI=1S/C8H10Cl2N2/c9-6-3-7(10)5-8(4-6)12-2-1-11/h3-5,12H,1-2,11H2 |
InChiKey: | InChIKey=TZRASYLGHOKHAN-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.