* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-GAMMA-GLU-HIS-OH |
CAS: | 37460-15-4 |
English Synonyms: | G-GLU-HIS ; H-GAMMA-GLU-HIS-OH ; H-GLU(HIS-OH)-OH |
MDL Number.: | MFCD00167469 |
H bond acceptor: | 9 |
H bond donor: | 5 |
Smile: | c1c(nc[nH]1)C[C@@H](C(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
InChi: | InChI=1S/C11H16N4O5/c12-7(10(17)18)1-2-9(16)15-8(11(19)20)3-6-4-13-5-14-6/h4-5,7-8H,1-3,12H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)/t7-,8-/m0/s1 |
InChiKey: | InChIKey=PXVCMZCJAUJLJP-YUMQZZPRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.