* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BUNAMIDINE |
| CAS: | 3748-77-4 |
| English Synonyms: | BUNAMIDINE |
| MDL Number.: | MFCD00864550 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCCCOc1ccc(c2c1cccc2)C(=N)N(CCCC)CCCC |
| InChi: | InChI=1S/C25H38N2O/c1-4-7-10-13-20-28-24-17-16-23(21-14-11-12-15-22(21)24)25(26)27(18-8-5-2)19-9-6-3/h11-12,14-17,26H,4-10,13,18-20H2,1-3H3 |
| InChiKey: | InChIKey=FGGFIMIICGZCCJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.