* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RUBIXANTHIN |
CAS: | 3763-55-1 |
English Synonyms: | RUBIXANTHIN |
MDL Number.: | MFCD00017388 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC1=C(C(CC(C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C=C(\C)/CCC=C(C)C)/C)/C |
InChi: | InChI=1S/C40H56O/c1-31(2)17-13-20-34(5)23-15-25-35(6)24-14-21-32(3)18-11-12-19-33(4)22-16-26-36(7)27-28-39-37(8)29-38(41)30-40(39,9)10/h11-12,14-19,21-28,38,41H,13,20,29-30H2,1-10H3/b12-11+,21-14+,22-16+,25-15+,28-27+,32-18+,33-19+,34-23+,35-24+,36-26+ |
InChiKey: | InChIKey=ABTRFGSPYXCGMR-HNNISBQLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.