* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | MET-TYR-PHE AMIDE |
CAS: | 37637-13-1 |
English Synonyms: | H-MET-TYR-PHE-NH2 ; MET-TYR-PHE AMIDE |
MDL Number.: | MFCD00038148 |
H bond acceptor: | 8 |
H bond donor: | 5 |
Smile: | CSCC[C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)N[C@@H](Cc2ccccc2)C(=O)N)N |
InChi: | InChI=1S/C23H30N4O4S/c1-32-12-11-18(24)22(30)27-20(14-16-7-9-17(28)10-8-16)23(31)26-19(21(25)29)13-15-5-3-2-4-6-15/h2-10,18-20,28H,11-14,24H2,1H3,(H2,25,29)(H,26,31)(H,27,30)/t18-,19-,20-/m0/s1 |
InChiKey: | InChIKey=BNRNLMADYYTCTK-UFYCRDLUSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.