* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (E)-ethyl 4-fluorobut-2-enoate |
CAS: | 37746-77-3 |
English Synonyms: | (E)-ETHYL 4-FLUOROBUT-2-ENOATE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC/C=C/C(=O)OCC |
InChi: | InChI=1S/C6H9FO2/c1-2-9-6(8)4-3-5-7/h3-4H,2,5H2,1H3/b4-3+ |
InChiKey: | InChIKey=FUQNDTQEJQPNFY-ONEGZZNKSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.