* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-BENZOYL-2-NAPHTHOIC ACID |
CAS: | 38119-08-3 |
English Synonyms: | 3-BENZOYL-2-NAPHTHOIC ACID |
MDL Number.: | MFCD00046479 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)C(=O)c2cc3ccccc3cc2C(=O)O |
InChi: | InChI=1S/C18H12O3/c19-17(12-6-2-1-3-7-12)15-10-13-8-4-5-9-14(13)11-16(15)18(20)21/h1-11H,(H,20,21) |
InChiKey: | InChIKey=GDYNSPPOLCIHSP-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.