* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DICOLINIUM IODIDE |
| CAS: | 382-82-1 |
| English Synonyms: | DICOLINIUM IODIDE |
| MDL Number.: | MFCD00867428 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CC[N+](C)(CC)CCOC(=O)C1CCCC([N+]1(C)C)C.[I-].[I-] |
| InChi: | InChI=1S/C16H34N2O2.2HI/c1-7-18(6,8-2)12-13-20-16(19)15-11-9-10-14(3)17(15,4)5;;/h14-15H,7-13H2,1-6H3;2*1H/q+2;;/p-2 |
| InChiKey: | InChIKey=UHMKISIRZFDJRU-UHFFFAOYSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.