* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(4-BROMO-PHENYL)-PIPERIDINE |
CAS: | 1228557-30-9 ;383128-14-1 |
English Synonyms: | 2-(4-BROMO-PHENYL)-PIPERIDINE |
MDL Number.: | MFCD02663580 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(ccc1C2CCCCN2)Br |
InChi: | InChI=1S/C11H14BrN/c12-10-6-4-9(5-7-10)11-3-1-2-8-13-11/h4-7,11,13H,1-3,8H2 |
InChiKey: | InChIKey=GHEZGFYJGORZRD-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.