Molecular Structure:
CAS No.:
383133-26-4
Product Name.:
CCD No.:CCD00328807
Formula:C9 H6 I N O2
MolWeight:287.051
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(17)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(3)
|
|
| Product Name： | 4-IODO-1H-INDOLE-2-CARBOXYLIC ACID |
| CAS： | 383133-26-4 |
| English Synonyms： | 4-IODO-1H-INDOLE-2-CARBOXYLIC ACID |
| MDL Number.： | MFCD02664508 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | c1cc2c(cc([nH]2)C(=O)O)c(c1)I |
| InChi： | InChI=1S/C9H6INO2/c10-6-2-1-3-7-5(6)4-8(11-7)9(12)13/h1-4,11H,(H,12,13) |
| InChiKey： | InChIKey=NTBNGNBTEWXGKN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
