* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PEROXYMALEIC ACID |
| CAS: | 3851-95-4 |
| English Synonyms: | PEROXYMALEIC ACID |
| MDL Number.: | MFCD16876608 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | C(=C\C(=O)OO)\C(=O)O |
| InChi: | InChI=1S/C4H4O5/c5-3(6)1-2-4(7)9-8/h1-2,8H,(H,5,6)/b2-1- |
| InChiKey: | InChIKey=KFHHPVVJLXPHJL-UPHRSURJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.