* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-LYSINE-UL-14C |
CAS: | 3506-25-0 ;3852-33-3 |
English Synonyms: | L-LYSINE-UL-14C ; LYSINE, L-[14C(U)] |
MDL Number.: | MFCD00083395 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | [14CH2]([14CH2][14CH2]N)[14CH2][14C@@H]([14C](=O)O)N |
InChi: | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1/i1+2,2+2,3+2,4+2,5+2,6+2 |
InChiKey: | InChIKey=KDXKERNSBIXSRK-BBQWBCSSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.