* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6,8-DIBROMO-3-BUTYRYL-2H-CHROMEN-2-ONE |
CAS: | 3855-85-4 |
English Synonyms: | 6,8-DIBROMO-3-BUTYRYL-2H-CHROMEN-2-ONE |
MDL Number.: | MFCD00052895 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCCC(=O)c1cc2cc(cc(c2oc1=O)Br)Br |
InChi: | InChI=1S/C13H10Br2O3/c1-2-3-11(16)9-5-7-4-8(14)6-10(15)12(7)18-13(9)17/h4-6H,2-3H2,1H3 |
InChiKey: | InChIKey=JOMXLHCIWLDDIM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.