* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-IODO-1H,1H,1H,2H,3H,3H-PERFLUORONONANE |
CAS: | 38550-34-4 |
English Synonyms: | 2-IODO-1H,1H,1H,2H,3H,3H-PERFLUORONONANE ; 1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-8-IODONONANE ; 2-IODO-1H,1H,1H,2H,3H,3H-PERFLUOROONOANE ; 1H,1H,1H,2H,3H,3H-PERFLUORO-2-IODONONANE |
MDL Number.: | MFCD00156018 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(CC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)I |
InChi: | InChI=1S/C9H6F13I/c1-3(23)2-4(10,11)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)22/h3H,2H2,1H3 |
InChiKey: | InChIKey=REPFTMOJFHVIBT-UHFFFAOYSA-N |
Property |
|
Boiling Point: | 69 DEG/11MM |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.