* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,10-DIMETHYL-PYRIMIDO[4,5-B]1,2-DIHYDROQUINOLIN-2,4-DIONE |
| CAS: | 38559-35-2 |
| English Synonyms: | 3,10-DIMETHYL-PYRIMIDO[4,5-B]1,2-DIHYDROQUINOLIN-2,4-DIONE |
| MDL Number.: | MFCD16875933 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | Cn1c2ccccc2cc-3c(=O)n(c(=O)nc13)C |
| InChi: | InChI=1S/C13H11N3O2/c1-15-10-6-4-3-5-8(10)7-9-11(15)14-13(18)16(2)12(9)17/h3-7H,1-2H3 |
| InChiKey: | InChIKey=AKVQGOMYPNAESS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.