* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AMINO TADALAFIL |
CAS: | 385769-84-6 |
English Synonyms: | AMINO TADALAFIL |
MDL Number.: | MFCD09752152 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)c3c([nH]2)C(N4C(C3)C(=O)N(CC4=O)N)c5ccc6c(c5)OCO6 |
InChi: | InChI=1S/C21H18N4O4/c22-24-9-18(26)25-15(21(24)27)8-13-12-3-1-2-4-14(12)23-19(13)20(25)11-5-6-16-17(7-11)29-10-28-16/h1-7,15,20,23H,8-10,22H2 |
InChiKey: | InChIKey=VUKJGAVIWMPOOJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.