* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(4-FLUOROPHENYL)-5-(2-NAPHTHYL)-1,3,4-OXADIAZOLE |
CAS: | 38736-15-1 |
English Synonyms: | 2-(4-FLUOROPHENYL)-5-(2-NAPHTHYL)-1,3,4-OXADIAZOLE |
MDL Number.: | MFCD00051027 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc2cc(ccc2c1)c3nnc(o3)c4ccc(cc4)F |
InChi: | InChI=1S/C18H11FN2O/c19-16-9-7-13(8-10-16)17-20-21-18(22-17)15-6-5-12-3-1-2-4-14(12)11-15/h1-11H |
InChiKey: | InChIKey=BFFQFOBHPRLZCN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.