Molecular Structure:
CAS No.:
38765-82-1
Product Name.:
CCD No.:CCD00090158
Formula:C5 H10 O2
MolWeight:103.121
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | VALERIC ACID-1-13C |
| CAS： | 38765-82-1 |
| English Synonyms： | PENTANOIC ACID-1-13C ; VALERIC ACID-1-13C |
| MDL Number.： | MFCD00190343 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CCCC[13C](=O)O |
| InChi： | InChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7)/i5+1 |
| InChiKey： | InChIKey=NQPDZGIKBAWPEJ-HOSYLAQJSA-N |
|
|
| Boiling Point： | 185 DEG C(LIT) |
| Density： | DENSITY: 0.948 G/ML AT 25 DEG C (EST)(LIT) |
| Physical Property： | FLASHPOINT: 190.4 DEG F FLASHPOINT: 88 DEG C |
| Comments： | MASS SHIFT: M+1 RIDADR: UN 3265 8/PG 3 WGK: 1 |
| Information： | ISOTOPIC PURITY: 99 ATOM % 13C |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
