* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7H-CYCLOPENTA[1,2-B:4,3-B']DITHIOPHENE |
CAS: | 389-55-9 |
English Synonyms: | 7H-CYCLOPENTA[1,2-B:4,3-B']DITHIOPHENE |
MDL Number.: | MFCD01927194 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1csc2c1-c3ccsc3C2 |
InChi: | InChI=1S/C9H6S2/c1-3-10-8-5-9-7(6(1)8)2-4-11-9/h1-4H,5H2 |
InChiKey: | InChIKey=BSHCQCQFFCOGEC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.