* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-ILE-LEU |
| CAS: | 38972-95-1 |
| English Synonyms: | Z-ILE-LEU-OH ; Z-ILE-LEU ; Z-L-ISOLEUCYL-L-LEUCINE |
| MDL Number.: | MFCD00056158 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC[C@H](C)[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C20H30N2O5/c1-5-14(4)17(18(23)21-16(19(24)25)11-13(2)3)22-20(26)27-12-15-9-7-6-8-10-15/h6-10,13-14,16-17H,5,11-12H2,1-4H3,(H,21,23)(H,22,26)(H,24,25)/t14-,16-,17-/m0/s1 |
| InChiKey: | InChIKey=BSRAGXJNZJMFMY-XIRDDKMYSA-N |
|
|
|
|
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.