* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HEXANAL, 2-METHYL-5-OXO-, (2R)- |
CAS: | 389837-65-4 |
English Synonyms: | HEXANAL, 2-METHYL-5-OXO-, (2R)- |
MDL Number.: | MFCD18829191 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C[C@H](CCC(=O)C)C=O |
InChi: | InChI=1S/C7H12O2/c1-6(5-8)3-4-7(2)9/h5-6H,3-4H2,1-2H3/t6-/m1/s1 |
InChiKey: | InChIKey=MNBADNSBGCNGGB-ZCFIWIBFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.