* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GELSEVIRINE |
CAS: | 38990-03-3 |
English Synonyms: | GELSEVIRINE |
MDL Number.: | MFCD17214788 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CN1C[C@]2([C@@H]3C[C@@H]4[C@]5([C@H]2[C@H]1[C@H]3CO4)c6ccccc6N(C5=O)OC)C=C |
InChi: | InChI=1S/C21H24N2O3/c1-4-20-11-22(2)17-12-10-26-16(9-14(12)20)21(18(17)20)13-7-5-6-8-15(13)23(25-3)19(21)24/h4-8,12,14,16-18H,1,9-11H2,2-3H3/t12-,14+,16+,17+,18-,20-,21-/m0/s1 |
InChiKey: | InChIKey=SSSCMFCWHWCCEH-MTYPYGCKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.