* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INOSINE-8-14C |
CAS: | 3926-71-4 |
English Synonyms: | INOSINE-8-14C |
MDL Number.: | MFCD00079386 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | c1nc2c(c(n1)O)n[14cH]n2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
InChi: | InChI=1S/C10H12N4O5/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18/h2-4,6-7,10,15-17H,1H2,(H,11,12,18)/t4-,6-,7-,10-/m1/s1/i3+2 |
InChiKey: | InChIKey=UGQMRVRMYYASKQ-USSWDBROSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.