* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOPORIOLIDE |
CAS: | 39262-31-2 |
English Synonyms: | ISOPORIOLIDE |
MDL Number.: | MFCD01740378 |
H bond acceptor: | 12 |
H bond donor: | 6 |
Smile: | Cc1c2cc3c(c1O)C(=O)CC(O3)c4ccc(c(c4)-c5cccc(c5O)C(=O)OC[C@@H]6[C@H]([C@@H]([C@H]([C@H](O2)O6)O)O)O)O |
InChi: | InChI=1S/C29H26O12/c1-11-18-9-20-22(23(11)32)17(31)8-19(39-20)12-5-6-16(30)15(7-12)13-3-2-4-14(24(13)33)28(37)38-10-21-25(34)26(35)27(36)29(40-18)41-21/h2-7,9,19,21,25-27,29-30,32-36H,8,10H2,1H3/t19?,21-,25-,26+,27-,29-/m1/s1 |
InChiKey: | InChIKey=ZGRAFMJBVGBGRY-KJCMPKONSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.