* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VANTAL |
| CAS: | 39474-56-1 |
| English Synonyms: | VANTAL |
| MDL Number.: | MFCD01728244 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CNC(=O)CSP(=S)(OC)OC.c1cc(ccc1C(c2ccc(cc2)Cl)C(Cl)(Cl)Cl)Cl |
| InChi: | InChI=1S/C14H9Cl5.C5H12NO3PS2/c15-11-5-1-9(2-6-11)13(14(17,18)19)10-3-7-12(16)8-4-10;1-6-5(7)4-12-10(11,8-2)9-3/h1-8,13H;4H2,1-3H3,(H,6,7) |
| InChiKey: | InChIKey=GELMBLHNDOQTJU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.