* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BEFUNOLOL |
| CAS: | 39552-01-7 |
| English Synonyms: | BEFUNOLOL |
| MDL Number.: | MFCD00864594 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)NCC(COc1cccc2c1oc(c2)C(=O)C)O |
| InChi: | InChI=1S/C16H21NO4/c1-10(2)17-8-13(19)9-20-14-6-4-5-12-7-15(11(3)18)21-16(12)14/h4-7,10,13,17,19H,8-9H2,1-3H3 |
| InChiKey: | InChIKey=ZPQPDBIHYCBNIG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.