* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-PHENYL[1,2,4]TRIAZOLO[1,5-A]PYRIMIDINE |
| CAS: | 39573-72-3 |
| English Synonyms: | 7-PHENYL[1,2,4]TRIAZOLO[1,5-A]PYRIMIDINE |
| MDL Number.: | MFCD00138766 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)c2ccnc3n2ncn3 |
| InChi: | InChI=1S/C11H8N4/c1-2-4-9(5-3-1)10-6-7-12-11-13-8-14-15(10)11/h1-8H |
| InChiKey: | InChIKey=NJZKWMXLDGCTGY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.