Molecular Structure:
CAS No.:
39756-36-0
Product Name.:
CCD No.:CCD00072097
Formula:C19 D40
MolWeight:308.769
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(5)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | N-NONADECANE-D40 |
| CAS： | 39756-36-0 |
| English Synonyms： | N-NONADECANE-D40 ; NONADECANE-D40 |
| MDL Number.： | MFCD00144991 |
| H bond acceptor： | 0 |
| H bond donor： | 0 |
| Smile： | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| InChiKey： | InChIKey=null |
|
|
| Melting Point： | 28-30 DEG C(LIT) |
| Boiling Point： | 330 DEG C(LIT) |
| Density： | DENSITY: 0.904 G/ML AT 25 DEG C |
| Physical Property： | FLASHPOINT: 113 DEG C FLASHPOINT: 235.4 DEG F VAPOR DENSITY: 9.27 (VS AIR) |
| Comments： | MASS SHIFT: M+40 UNSPSC: 12142200 WGK: 3 |
| Information： | ISOTOPIC PURITY: 98 ATOM % D MW: 307.97 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
