* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SPIRO[BENZO[E][1,3]OXAZINE-2,1'-CYCLOPENTAN]-4(3H)-ONE |
CAS: | 40033-94-1 |
English Synonyms: | SPIRO[BENZO[E][1,3]OXAZINE-2,1'-CYCLOPENTAN]-4(3H)-ONE |
MDL Number.: | MFCD00487797 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)C(=O)NC3(O2)CCCC3 |
InChi: | InChI=1S/C12H13NO2/c14-11-9-5-1-2-6-10(9)15-12(13-11)7-3-4-8-12/h1-2,5-6H,3-4,7-8H2,(H,13,14) |
InChiKey: | InChIKey=BSPVYWBNGUTBQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.