* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL BROMOACETATE 1,2-14C |
CAS: | 40145-35-5 |
English Synonyms: | ETHYL BROMOACETATE 1,2-14C |
MDL Number.: | MFCD00189670 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCO[14C](=O)[14CH2]Br |
InChi: | InChI=1S/C4H7BrO2/c1-2-7-4(6)3-5/h2-3H2,1H3/i3+2,4+2 |
InChiKey: | InChIKey=PQJJJMRNHATNKG-NUQCWPJISA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.