* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(2,3-DIFLUOROPHENOXY)BUTAN-1-OL |
CAS: | 402860-14-4 |
English Synonyms: | 4-(2,3-DIFLUOROPHENOXY)BUTAN-1-OL |
MDL Number.: | MFCD17282177 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(c(c(c1)F)F)OCCCCO |
InChi: | InChI=1S/C10H12F2O2/c11-8-4-3-5-9(10(8)12)14-7-2-1-6-13/h3-5,13H,1-2,6-7H2 |
InChiKey: | InChIKey=XJNLAHYQGBPVFX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.