* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | P-MENTH-1-ENE-3,6-DIOL |
CAS: | 4031-55-4 |
English Synonyms: | P-MENTH-1-ENE-3,6-DIOL |
MDL Number.: | MFCD17214865 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CC1=C[C@@H]([C@H](C[C@@H]1O)C(C)C)O |
InChi: | InChI=1S/C10H18O2/c1-6(2)8-5-9(11)7(3)4-10(8)12/h4,6,8-12H,5H2,1-3H3/t8-,9+,10+/m1/s1 |
InChiKey: | InChIKey=CDEBGVXOFDWUAF-UTLUCORTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.