* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,1-BENZISOTHIAZOL-3(1H)-ONE |
| CAS: | 40352-87-2 |
| English Synonyms: | 2,1-BENZISOTHIAZOL-3(1H)-ONE ; 2,1-BENZOTHIAZOL-3-OL |
| MDL Number.: | MFCD00127754 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)c(sn2)O |
| InChi: | InChI=1S/C7H5NOS/c9-7-5-3-1-2-4-6(5)8-10-7/h1-4,9H |
| InChiKey: | InChIKey=GOZZIGCVWYMIFS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.