* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-METHYL-4-OCTANOL |
CAS: | 40575-41-5 |
English Synonyms: | 2-METHYL-4-OCTANOL ; 2-METHYLOCTAN-4-OL |
MDL Number.: | MFCD00039625 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCCCC(CC(C)C)O |
InChi: | InChI=1S/C9H20O/c1-4-5-6-9(10)7-8(2)3/h8-10H,4-7H2,1-3H3 |
InChiKey: | InChIKey=BIAVIOIDPRPYJK-UHFFFAOYSA-N |
Property |
|
Boiling Point: | 872 DEG C |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.