* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,3,4,6-TETRA-O-METHYL-D-GALACTOSE |
| CAS: | 4060-05-3 |
| English Synonyms: | 2,3,4,6-TETRA-O-METHYL-D-GALACTOSE |
| MDL Number.: | MFCD00171520 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CO[C@H](CO)[C@@H]([C@@H]([C@H](C=O)OC)OC)OC |
| InChi: | InChI=1S/C10H20O6/c1-13-7(5-11)9(15-3)10(16-4)8(6-12)14-2/h5,7-10,12H,6H2,1-4H3/t7-,8+,9+,10-/m0/s1 |
| InChiKey: | InChIKey=ZHDUHOGDACXESL-JLIMGVALSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.