* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-LEU-TYR-OH |
| CAS: | 40908-35-8 |
| English Synonyms: | Z-L-LEUCYL-L-TYROSINE ; Z-LEU-TYR ; Z-LEU-TYR-OH |
| MDL Number.: | MFCD00055740 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | CC(C)C[C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)O)NC(=O)OCc2ccccc2 |
| InChi: | InChI=1S/C23H28N2O6/c1-15(2)12-19(25-23(30)31-14-17-6-4-3-5-7-17)21(27)24-20(22(28)29)13-16-8-10-18(26)11-9-16/h3-11,15,19-20,26H,12-14H2,1-2H3,(H,24,27)(H,25,30)(H,28,29)/t19-,20-/m0/s1 |
| InChiKey: | InChIKey=LYFZBGIZNYYJJR-PMACEKPBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.