* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,6-DI-TERT-BUTYL-4-CHLOROPHENOL |
CAS: | 4096-72-4 |
English Synonyms: | 2,6-DI-TERT-BUTYL-4-CHLOROPHENOL |
MDL Number.: | MFCD00087733 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C)(C)c1cc(cc(c1O)C(C)(C)C)Cl |
InChi: | InChI=1S/C14H21ClO/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7-8,16H,1-6H3 |
InChiKey: | InChIKey=WLQMYDWPKCQDPQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.