* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LIPIFEROLIDE |
CAS: | 41059-80-7 |
English Synonyms: | LIPIFEROLIDE |
MDL Number.: | MFCD17214863 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | C/C/1=C\CC[C@@]2([C@H](O2)[C@@H]3[C@@H]([C@@H](C1)OC(=O)C)C(=C)C(=O)O3)C |
InChi: | InChI=1S/C17H22O5/c1-9-6-5-7-17(4)15(22-17)14-13(10(2)16(19)21-14)12(8-9)20-11(3)18/h6,12-15H,2,5,7-8H2,1,3-4H3/b9-6+/t12-,13-,14+,15-,17-/m1/s1 |
InChiKey: | InChIKey=ODYJJNFWFYUXSS-WQROVURFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.