* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-ETHYLHEXANOIC ACID |
| CAS: | 41065-91-2 |
| English Synonyms: | 3-ETHYLHEXANOIC ACID |
| MDL Number.: | MFCD00049200 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCC(CC)CC(=O)O |
| InChi: | InChI=1S/C8H16O2/c1-3-5-7(4-2)6-8(9)10/h7H,3-6H2,1-2H3,(H,9,10) |
| InChiKey: | InChIKey=UWWDUVVCVCAPNU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.