* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SUCCINIC ANHYDRIDE-13C4 |
CAS: | 411220-47-8 |
English Synonyms: | SUCCINIC ANHYDRIDE-13C4 |
MDL Number.: | MFCD04118133 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | [13CH2]1[13CH2][13C](=O)O[13C]1=O |
InChi: | InChI=1S/C4H4O3/c5-3-1-2-4(6)7-3/h1-2H2/i1+1,2+1,3+1,4+1 |
InChiKey: | InChIKey=RINCXYDBBGOEEQ-JCDJMFQYSA-N |
Property |
|
Melting Point: | 118-120 DEG C(LIT) |
Boiling Point: | 261 DEG C |
Comments: | MASS SHIFT: M+4 WGK: 1 |
Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 104.01 BY ATOM % CALCULATION |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.