* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-METHOXY-2-BUTANOL |
| CAS: | 41223-27-2 |
| English Synonyms: | 4-METHOXY-2-BUTANOL ; 4-METHOXYBUTAN-2-OL |
| MDL Number.: | MFCD09753672 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(CCOC)O |
| InChi: | InChI=1S/C5H12O2/c1-5(6)3-4-7-2/h5-6H,3-4H2,1-2H3 |
| InChiKey: | InChIKey=METPUBMTPUYMGR-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.