* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(2-ACETOXYPHENYL)-1-PROPENE |
CAS: | 4125-54-6 |
English Synonyms: | 2-(PROP-2-EN-1-YL)PHENYL ACETATE ; 3-(2-ACETOXYPHENYL)-1-PROPENE |
MDL Number.: | MFCD00297370 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC(=O)Oc1ccccc1CC=C |
InChi: | InChI=1S/C11H12O2/c1-3-6-10-7-4-5-8-11(10)13-9(2)12/h3-5,7-8H,1,6H2,2H3 |
InChiKey: | InChIKey=LRUIUFBTAZTATM-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.