* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Glycine, N-hexyl- |
CAS: | 41331-10-6 |
English Synonyms: | GLYCINE, N-HEXYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(CCCCC)NCC(=O)O |
InChi: | InChI=1S/C8H17NO2/c1-2-3-4-5-6-9-7-8(10)11/h9H,2-7H2,1H3,(H,10,11) |
InChiKey: | InChIKey=DAQPDSNNUNDKNX-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.