* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(4-BROMOPHENYL)-1,3,4-OXADIAZOLE |
CAS: | 41420-90-0 |
English Synonyms: | 2-(4-BROMOPHENYL)-1,3,4-OXADIAZOLE ; 1,3,4-OXADIAZOLE, 2-(4-BROMOPHENYL)- |
MDL Number.: | MFCD00491614 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc(ccc1c2nnco2)Br |
InChi: | InChI=1S/C8H5BrN2O/c9-7-3-1-6(2-4-7)8-11-10-5-12-8/h1-5H |
InChiKey: | InChIKey=UGBVZNXXRZISHN-UHFFFAOYSA-N |
Property |
|
Melting Point: | 142-147 DEG C |
Comments: | RIDADR: UN 2811 6.1/PG 3 WGK: 3 |
Safety information |
|
Symbol: | GHS07 |
Signal word: | Warning |
Hazard statements: | H302 |
hazard symbol: | Xn |
Risk Code: | R:22 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.