* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | STEGANACIN |
CAS: | 41451-68-7 |
English Synonyms: | STEGANACIN |
MDL Number.: | MFCD01660168 |
H bond acceptor: | 9 |
H bond donor: | 0 |
Smile: | CC(=O)O[C@@H]1c2cc3c(cc2-c4c(cc(c(c4OC)OC)OC)C[C@H]5[C@H]1COC5=O)OCO3 |
InChi: | InChI=1S/C24H24O9/c1-11(25)33-21-14-8-18-17(31-10-32-18)7-13(14)20-12(5-15-16(21)9-30-24(15)26)6-19(27-2)22(28-3)23(20)29-4/h6-8,15-16,21H,5,9-10H2,1-4H3/t15-,16+,21+/m0/s1 |
InChiKey: | InChIKey=XJTXBUKLGQCZHC-GCKMJXCFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.